C12H17NO5 — CID 170829175
3-(3-amino-1,2-dihydroxypropyl)-4,5-dimethoxybenzaldehyde (PubChem CID 170829175) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 3-(3-amino-1,2-dihydroxypropyl)-4,5-dimethoxybenzaldehyde.
| Compound Name | 3-(3-amino-1,2-dihydroxypropyl)-4,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 170829175 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 3-(3-amino-1,2-dihydroxypropyl)-4,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)cc(C(O)C(O)CN)c1OC |
| InChI | InChI=1S/C12H17NO5/c1-17-10-4-7(6-14)3-8(12(10)18-2)11(16)9(15)5-13/h3-4,6,9,11,15-16H,5,13H2,1-2H3 |
| InChIKey | GVVUAHWGXKMYAE-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|