C12H15NO6 — CID 171869052
3-(4-formyl-2,6-dimethoxyphenyl)-2,3-dihydroxypropanamide (PubChem CID 171869052) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is 3-(4-formyl-2,6-dimethoxyphenyl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(4-formyl-2,6-dimethoxyphenyl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171869052 |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 3-(4-formyl-2,6-dimethoxyphenyl)-2,3-dihydroxypropanamide |
| SMILES | COc1cc(C=O)cc(OC)c1C(O)C(O)C(N)=O |
| InChI | InChI=1S/C12H15NO6/c1-18-7-3-6(5-14)4-8(19-2)9(7)10(15)11(16)12(13)17/h3-5,10-11,15-16H,1-2H3,(H2,13,17) |
| InChIKey | RJFZENAEGKSTOL-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|