C11H9NO5 — CID 171014104
2-(2-cyano-4-formyl-6-methoxyphenyl)-2-hydroxyacetic acid (PubChem CID 171014104) has the molecular formula C11H9NO5 and a molecular weight of 235.19 g/mol. Its IUPAC name is 2-(2-cyano-4-formyl-6-methoxyphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(2-cyano-4-formyl-6-methoxyphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 171014104 |
| Molecular Formula | C11H9NO5 |
| Molecular Weight | 235.19 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 2-(2-cyano-4-formyl-6-methoxyphenyl)-2-hydroxyacetic acid |
| SMILES | COc1cc(C=O)cc(C#N)c1C(O)C(=O)O |
| InChI | InChI=1S/C11H9NO5/c1-17-8-3-6(5-13)2-7(4-12)9(8)10(14)11(15)16/h2-3,5,10,14H,1H3,(H,15,16) |
| InChIKey | WRMBERWZOIIWHI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|