C12H11NO3 — CID 169484202
3-(4-formyl-2,6-dimethoxyphenyl)prop-2-enenitrile (PubChem CID 169484202) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is 3-(4-formyl-2,6-dimethoxyphenyl)prop-2-enenitrile.
| Compound Name | 3-(4-formyl-2,6-dimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169484202 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 3-(4-formyl-2,6-dimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(C=O)cc(OC)c1C=CC#N |
| InChI | InChI=1S/C12H11NO3/c1-15-11-6-9(8-14)7-12(16-2)10(11)4-3-5-13/h3-4,6-8H,1-2H3 |
| InChIKey | ZBQPRLOVCBGSLX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|