C10H11NO4 — CID 21281019
N-(4-formyl-2,6-dimethoxyphenyl)formamide (PubChem CID 21281019) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is N-(4-formyl-2,6-dimethoxyphenyl)formamide.
| Compound Name | N-(4-formyl-2,6-dimethoxyphenyl)formamide |
|---|---|
| PubChem CID | 21281019 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | N-(4-formyl-2,6-dimethoxyphenyl)formamide |
| SMILES | COc1cc(C=O)cc(OC)c1NC=O |
| InChI | InChI=1S/C10H11NO4/c1-14-8-3-7(5-12)4-9(15-2)10(8)11-6-13/h3-6H,1-2H3,(H,11,13) |
| InChIKey | CSZBRVLGTHERGR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|