C11H11NO3 — CID 117293177
2-(5-formyl-2,3-dimethoxyphenyl)acetonitrile (PubChem CID 117293177) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-(5-formyl-2,3-dimethoxyphenyl)acetonitrile.
| Compound Name | 2-(5-formyl-2,3-dimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 117293177 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-(5-formyl-2,3-dimethoxyphenyl)acetonitrile |
| SMILES | COc1cc(C=O)cc(CC#N)c1OC |
| InChI | InChI=1S/C11H11NO3/c1-14-10-6-8(7-13)5-9(3-4-12)11(10)15-2/h5-7H,3H2,1-2H3 |
| InChIKey | LCJGJURFTJLWSM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|