C11H12FNO3 — CID 117322895
2-(3-fluoro-2,4,5-trimethoxyphenyl)acetonitrile (PubChem CID 117322895) has the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. Its IUPAC name is 2-(3-fluoro-2,4,5-trimethoxyphenyl)acetonitrile.
| Compound Name | 2-(3-fluoro-2,4,5-trimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 117322895 |
| Molecular Formula | C11H12FNO3 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-(3-fluoro-2,4,5-trimethoxyphenyl)acetonitrile |
| SMILES | COc1cc(CC#N)c(OC)c(F)c1OC |
| InChI | InChI=1S/C11H12FNO3/c1-14-8-6-7(4-5-13)10(15-2)9(12)11(8)16-3/h6H,4H2,1-3H3 |
| InChIKey | IOKWGWFZKPCVJK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |