C11H12FNO2 — CID 117298346
2-(5-fluoro-3,4-dimethoxy-2-methylphenyl)acetonitrile (PubChem CID 117298346) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is 2-(5-fluoro-3,4-dimethoxy-2-methylphenyl)acetonitrile.
| Compound Name | 2-(5-fluoro-3,4-dimethoxy-2-methylphenyl)acetonitrile |
|---|---|
| PubChem CID | 117298346 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-(5-fluoro-3,4-dimethoxy-2-methylphenyl)acetonitrile |
| SMILES | COc1c(F)cc(CC#N)c(C)c1OC |
| InChI | InChI=1S/C11H12FNO2/c1-7-8(4-5-13)6-9(12)11(15-3)10(7)14-2/h6H,4H2,1-3H3 |
| InChIKey | ZTNHBTCTGQNFME-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |