C12H18O4 — CID 143400832
ethane;3,4,5-trimethoxybenzaldehyde (PubChem CID 143400832) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is ethane;3,4,5-trimethoxybenzaldehyde.
| Compound Name | ethane;3,4,5-trimethoxybenzaldehyde |
|---|---|
| PubChem CID | 143400832 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | ethane;3,4,5-trimethoxybenzaldehyde |
| SMILES | CC.COc1cc(C=O)cc(OC)c1OC |
| InChI | InChI=1S/C10H12O4.C2H6/c1-12-8-4-7(6-11)5-9(13-2)10(8)14-3;1-2/h4-6H,1-3H3;1-2H3 |
| InChIKey | RNWZCUJJWRIFSV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|