C17H27NO7 — CID 87631522
3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-4,5-dimethoxybenzaldehyde (PubChem CID 87631522) has the molecular formula C17H27NO7 and a molecular weight of 357.40 g/mol. Its IUPAC name is 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-4,5-dimethoxybenzaldehyde.
| Compound Name | 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-4,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 87631522 |
| Molecular Formula | C17H27NO7 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-4,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)cc(OCCOCCOCCOCCN)c1OC |
| InChI | InChI=1S/C17H27NO7/c1-20-15-11-14(13-19)12-16(17(15)21-2)25-10-9-24-8-7-23-6-5-22-4-3-18/h11-13H,3-10,18H2,1-2H3 |
| InChIKey | DRIQSQDXSJDDPW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|