C12H13F3O4 — CID 61490686
4-methoxy-3-[2-(2,2,2-trifluoroethoxy)ethoxy]benzaldehyde (PubChem CID 61490686) has the molecular formula C12H13F3O4 and a molecular weight of 278.23 g/mol. Its IUPAC name is 4-methoxy-3-[2-(2,2,2-trifluoroethoxy)ethoxy]benzaldehyde.
| Compound Name | 4-methoxy-3-[2-(2,2,2-trifluoroethoxy)ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 61490686 |
| Molecular Formula | C12H13F3O4 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 4-methoxy-3-[2-(2,2,2-trifluoroethoxy)ethoxy]benzaldehyde |
| SMILES | COc1ccc(C=O)cc1OCCOCC(F)(F)F |
| InChI | InChI=1S/C12H13F3O4/c1-17-10-3-2-9(7-16)6-11(10)19-5-4-18-8-12(13,14)15/h2-3,6-7H,4-5,8H2,1H3 |
| InChIKey | QATWXOSKWYIDFG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|