C16H13Cl3O4 — CID 20985477
4-methoxy-3-[2-(2,4,6-trichlorophenoxy)ethoxy]benzaldehyde (PubChem CID 20985477) has the molecular formula C16H13Cl3O4 and a molecular weight of 375.64 g/mol. Its IUPAC name is 4-methoxy-3-[2-(2,4,6-trichlorophenoxy)ethoxy]benzaldehyde.
| Compound Name | 4-methoxy-3-[2-(2,4,6-trichlorophenoxy)ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 20985477 |
| Molecular Formula | C16H13Cl3O4 |
| Molecular Weight | 375.64 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 4-methoxy-3-[2-(2,4,6-trichlorophenoxy)ethoxy]benzaldehyde |
| SMILES | COc1ccc(C=O)cc1OCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl3O4/c1-21-14-3-2-10(9-20)6-15(14)22-4-5-23-16-12(18)7-11(17)8-13(16)19/h2-3,6-9H,4-5H2,1H3 |
| InChIKey | YBGANRZGRASVOI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|