C17H26N2O4 — CID 10496079
3,4-dimethoxy-5-[3-(4-methylpiperazin-1-yl)propoxy]benzaldehyde (PubChem CID 10496079) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 3,4-dimethoxy-5-[3-(4-methylpiperazin-1-yl)propoxy]benzaldehyde.
| Compound Name | 3,4-dimethoxy-5-[3-(4-methylpiperazin-1-yl)propoxy]benzaldehyde |
|---|---|
| PubChem CID | 10496079 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 3,4-dimethoxy-5-[3-(4-methylpiperazin-1-yl)propoxy]benzaldehyde |
| SMILES | COc1cc(C=O)cc(OCCCN2CCN(C)CC2)c1OC |
| InChI | InChI=1S/C17H26N2O4/c1-18-6-8-19(9-7-18)5-4-10-23-16-12-14(13-20)11-15(21-2)17(16)22-3/h11-13H,4-10H2,1-3H3 |
| InChIKey | UQZGGMTVKQRIRM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|