C32H44N2O10 — CID 11570830
3-[4-[3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]piperazin-1-yl]propyl 3,4,5-trimethoxybenzoate (PubChem CID 11570830) has the molecular formula C32H44N2O10 and a molecular weight of 616.71 g/mol. Its IUPAC name is 3-[4-[3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]piperazin-1-yl]propyl 3,4,5-trimethoxybenzoate.
| Compound Name | 3-[4-[3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]piperazin-1-yl]propyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 11570830 |
| Molecular Formula | C32H44N2O10 |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | 3-[4-[3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]piperazin-1-yl]propyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(/C=C/C(=O)OCCCN2CCN(CCCOC(=O)c3cc(OC)c(OC)c(OC)c3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C32H44N2O10/c1-37-25-19-23(20-26(38-2)30(25)41-5)9-10-29(35)43-17-7-11-33-13-15-34(16-14-33)12-8-18-44-32(36)24-21-27(39-3)31(42-6)28(22-24)40-4/h9-10,19-22H,7-8,11-18H2,1-6H3/b10-9+ |
| InChIKey | UPCKASFMIQLAMV-MDZDMXLPSA-N |
| XLogP | 3.55 |
| TPSA | 114.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|