C33H47NO10 — CID 155539307
3-[methyl-[7-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyheptyl]amino]propyl 3,4,5-trimethoxybenzoate (PubChem CID 155539307) has the molecular formula C33H47NO10 and a molecular weight of 617.74 g/mol. Its IUPAC name is 3-[methyl-[7-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyheptyl]amino]propyl 3,4,5-trimethoxybenzoate.
| Compound Name | 3-[methyl-[7-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyheptyl]amino]propyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 155539307 |
| Molecular Formula | C33H47NO10 |
| Molecular Weight | 617.74 g/mol |
| Exact Mass | 617.32 |
| IUPAC Name | 3-[methyl-[7-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyheptyl]amino]propyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(/C=C/C(=O)OCCCCCCCN(C)CCCOC(=O)c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C33H47NO10/c1-34(17-13-19-44-33(36)25-22-28(39-4)32(42-7)29(23-25)40-5)16-11-9-8-10-12-18-43-30(35)15-14-24-20-26(37-2)31(41-6)27(21-24)38-3/h14-15,20-23H,8-13,16-19H2,1-7H3/b15-14+ |
| InChIKey | SOGJAKADFIGMQE-CCEZHUSRSA-N |
| XLogP | 5.42 |
| TPSA | 111.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.74 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|