C35H49NO14 — CID 11664816
2-[2-[(2-methylpropan-2-yl)oxycarbonyl-[2-[2-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyethoxy]ethyl]amino]ethoxy]ethyl 3,4,5-trimethoxybenzoate (PubChem CID 11664816) has the molecular formula C35H49NO14 and a molecular weight of 707.77 g/mol. Its IUPAC name is 2-[2-[(2-methylpropan-2-yl)oxycarbonyl-[2-[2-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyethoxy]ethyl]amino]ethoxy]ethyl 3,4,5-trimethoxybenzoate.
| Compound Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonyl-[2-[2-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyethoxy]ethyl]amino]ethoxy]ethyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 11664816 |
| Molecular Formula | C35H49NO14 |
| Molecular Weight | 707.77 g/mol |
| Exact Mass | 707.32 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonyl-[2-[2-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyethoxy]ethyl]amino]ethoxy]ethyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(/C=C/C(=O)OCCOCCN(CCOCCOC(=O)c2cc(OC)c(OC)c(OC)c2)C(=O)OC(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C35H49NO14/c1-35(2,3)50-34(39)36(13-15-47-17-19-49-33(38)25-22-28(42-6)32(45-9)29(23-25)43-7)12-14-46-16-18-48-30(37)11-10-24-20-26(40-4)31(44-8)27(21-24)41-5/h10-11,20-23H,12-19H2,1-9H3/b11-10+ |
| InChIKey | FCYJNLWMWYDZPV-ZHACJKMWSA-N |
| XLogP | 4.42 |
| TPSA | 155.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.77 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|