C17H27NO5 — CID 132794544
2-[tert-butyl(methyl)amino]ethyl 3,4,5-trimethoxybenzoate (PubChem CID 132794544) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-[tert-butyl(methyl)amino]ethyl 3,4,5-trimethoxybenzoate.
| Compound Name | 2-[tert-butyl(methyl)amino]ethyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 132794544 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-[tert-butyl(methyl)amino]ethyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCCN(C)C(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C17H27NO5/c1-17(2,3)18(4)8-9-23-16(19)12-10-13(20-5)15(22-7)14(11-12)21-6/h10-11H,8-9H2,1-7H3 |
| InChIKey | UXYIIIBGIVCILN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |