C16H26ClNO5 — CID 20291
diethyl-[2-(3,4,5-trimethoxybenzoyl)oxyethyl]azanium chloride (PubChem CID 20291) has the molecular formula C16H26ClNO5 and a molecular weight of 347.84 g/mol. Its IUPAC name is diethyl-[2-(3,4,5-trimethoxybenzoyl)oxyethyl]azanium chloride.
| Compound Name | diethyl-[2-(3,4,5-trimethoxybenzoyl)oxyethyl]azanium chloride |
|---|---|
| PubChem CID | 20291 |
| Molecular Formula | C16H26ClNO5 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | diethyl-[2-(3,4,5-trimethoxybenzoyl)oxyethyl]azanium chloride |
| SMILES | CC[NH+](CC)CCOC(=O)c1cc(OC)c(OC)c(OC)c1.[Cl-] |
| InChI | InChI=1S/C16H25NO5.ClH/c1-6-17(7-2)8-9-22-16(18)12-10-13(19-3)15(21-5)14(11-12)20-4;/h10-11H,6-9H2,1-5H3;1H |
| InChIKey | SLNGWZYXXOJBKC-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |