C25H36ClNO8 — CID 110186006
2-(3,4-dimethoxyphenoxy)ethyl-ethyl-[3-(3,4,5-trimethoxybenzoyl)oxypropyl]azanium chloride (PubChem CID 110186006) has the molecular formula C25H36ClNO8 and a molecular weight of 514.02 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenoxy)ethyl-ethyl-[3-(3,4,5-trimethoxybenzoyl)oxypropyl]azanium chloride.
| Compound Name | 2-(3,4-dimethoxyphenoxy)ethyl-ethyl-[3-(3,4,5-trimethoxybenzoyl)oxypropyl]azanium chloride |
|---|---|
| PubChem CID | 110186006 |
| Molecular Formula | C25H36ClNO8 |
| Molecular Weight | 514.02 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | 2-(3,4-dimethoxyphenoxy)ethyl-ethyl-[3-(3,4,5-trimethoxybenzoyl)oxypropyl]azanium chloride |
| SMILES | CC[NH+](CCCOC(=O)c1cc(OC)c(OC)c(OC)c1)CCOc1ccc(OC)c(OC)c1.[Cl-] |
| InChI | InChI=1S/C25H35NO8.ClH/c1-7-26(12-14-33-19-9-10-20(28-2)21(17-19)29-3)11-8-13-34-25(27)18-15-22(30-4)24(32-6)23(16-18)31-5;/h9-10,15-17H,7-8,11-14H2,1-6H3;1H |
| InChIKey | BETJXXLLNFILPH-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.02 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|