C23H30O5 — CID 2425617
(4-tert-butyl-2,6-dimethylphenyl)methyl 3,4,5-trimethoxybenzoate (PubChem CID 2425617) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)methyl 3,4,5-trimethoxybenzoate.
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)methyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 2425617 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)methyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCc2c(C)cc(C(C)(C)C)cc2C)cc(OC)c1OC |
| InChI | InChI=1S/C23H30O5/c1-14-9-17(23(3,4)5)10-15(2)18(14)13-28-22(24)16-11-19(25-6)21(27-8)20(12-16)26-7/h9-12H,13H2,1-8H3 |
| InChIKey | BHNQNFNYCNYJRL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |