C20H24O3 — CID 23850196
(4-tert-butyl-2,6-dimethylphenyl)methyl 3-hydroxybenzoate (PubChem CID 23850196) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)methyl 3-hydroxybenzoate.
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)methyl 3-hydroxybenzoate |
|---|---|
| PubChem CID | 23850196 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)methyl 3-hydroxybenzoate |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1COC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C20H24O3/c1-13-9-16(20(3,4)5)10-14(2)18(13)12-23-19(22)15-7-6-8-17(21)11-15/h6-11,21H,12H2,1-5H3 |
| InChIKey | JWGHBCZOYIEJFN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |