About benzyl 3-hydroxybenzoate
benzyl 3-hydroxybenzoate (PubChem CID 11736317) has the molecular formula C14H12O3
and a molecular weight of 228.25 g/mol. Its IUPAC name is benzyl 3-hydroxybenzoate.
Molecular Properties
| Compound Name | benzyl 3-hydroxybenzoate |
| PubChem CID | 11736317 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | benzyl 3-hydroxybenzoate |
| SMILES | O=C(OCc1ccccc1)c1cccc(O)c1 |
| InChI | InChI=1S/C14H12O3/c15-13-8-4-7-12(9-13)14(16)17-10-11-5-2-1-3-6-11/h1-9,15H,10H2 |
| InChIKey | QCLMZTCDRVMSHA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 3-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-hydroxybenzoate?
The IUPAC name of benzyl 3-hydroxybenzoate (CID 11736317) is benzyl 3-hydroxybenzoate.
What is the SMILES notation for benzyl 3-hydroxybenzoate?
The canonical SMILES for benzyl 3-hydroxybenzoate is O=C(OCc1ccccc1)c1cccc(O)c1.
What is the InChIKey of benzyl 3-hydroxybenzoate?
The InChIKey is QCLMZTCDRVMSHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O3/c15-13-8-4-7-12(9-13)14(16)17-10-11-5-2-1-3-6-11/h1-9,15H,10H2.
What are the key properties of benzyl 3-hydroxybenzoate?
benzyl 3-hydroxybenzoate has a molecular weight of 228.25 g/mol, XLogP of 2.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-hydroxybenzoate is sourced from PubChem (CID 11736317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).