About (3-methylphenyl)methyl 3-hydroxybenzoate
(3-methylphenyl)methyl 3-hydroxybenzoate (PubChem CID 44587285) has the molecular formula C15H14O3
and a molecular weight of 242.27 g/mol. Its IUPAC name is (3-methylphenyl)methyl 3-hydroxybenzoate.
Molecular Properties
| Compound Name | (3-methylphenyl)methyl 3-hydroxybenzoate |
| PubChem CID | 44587285 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (3-methylphenyl)methyl 3-hydroxybenzoate |
| SMILES | Cc1cccc(COC(=O)c2cccc(O)c2)c1 |
| InChI | InChI=1S/C15H14O3/c1-11-4-2-5-12(8-11)10-18-15(17)13-6-3-7-14(16)9-13/h2-9,16H,10H2,1H3 |
| InChIKey | QHEXQUDRRDUIRV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methylphenyl)methyl 3-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylphenyl)methyl 3-hydroxybenzoate?
The IUPAC name of (3-methylphenyl)methyl 3-hydroxybenzoate (CID 44587285) is (3-methylphenyl)methyl 3-hydroxybenzoate.
What is the SMILES notation for (3-methylphenyl)methyl 3-hydroxybenzoate?
The canonical SMILES for (3-methylphenyl)methyl 3-hydroxybenzoate is Cc1cccc(COC(=O)c2cccc(O)c2)c1.
What is the InChIKey of (3-methylphenyl)methyl 3-hydroxybenzoate?
The InChIKey is QHEXQUDRRDUIRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O3/c1-11-4-2-5-12(8-11)10-18-15(17)13-6-3-7-14(16)9-13/h2-9,16H,10H2,1H3.
What are the key properties of (3-methylphenyl)methyl 3-hydroxybenzoate?
(3-methylphenyl)methyl 3-hydroxybenzoate has a molecular weight of 242.27 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl)methyl 3-hydroxybenzoate is sourced from PubChem (CID 44587285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).