C19H17NO3S — CID 55451662
(3-methylphenyl)methyl 3-(1,3-thiazol-4-ylmethoxy)benzoate (PubChem CID 55451662) has the molecular formula C19H17NO3S and a molecular weight of 339.42 g/mol. Its IUPAC name is (3-methylphenyl)methyl 3-(1,3-thiazol-4-ylmethoxy)benzoate.
| Compound Name | (3-methylphenyl)methyl 3-(1,3-thiazol-4-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 55451662 |
| Molecular Formula | C19H17NO3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (3-methylphenyl)methyl 3-(1,3-thiazol-4-ylmethoxy)benzoate |
| SMILES | Cc1cccc(COC(=O)c2cccc(OCc3cscn3)c2)c1 |
| InChI | InChI=1S/C19H17NO3S/c1-14-4-2-5-15(8-14)10-23-19(21)16-6-3-7-18(9-16)22-11-17-12-24-13-20-17/h2-9,12-13H,10-11H2,1H3 |
| InChIKey | KTRDZDKKSCQQBV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |