C20H14N4O6S — CID 55737843
[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-(1,3-thiazol-4-ylmethoxy)benzoate (PubChem CID 55737843) has the molecular formula C20H14N4O6S and a molecular weight of 438.42 g/mol. Its IUPAC name is [3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-(1,3-thiazol-4-ylmethoxy)benzoate.
| Compound Name | [3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-(1,3-thiazol-4-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 55737843 |
| Molecular Formula | C20H14N4O6S |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | [3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-(1,3-thiazol-4-ylmethoxy)benzoate |
| SMILES | O=C(OCc1nc(-c2ccc([N+](=O)[O-])cc2)no1)c1cccc(OCc2cscn2)c1 |
| InChI | InChI=1S/C20H14N4O6S/c25-20(14-2-1-3-17(8-14)28-9-15-11-31-12-21-15)29-10-18-22-19(23-30-18)13-4-6-16(7-5-13)24(26)27/h1-8,11-12H,9-10H2 |
| InChIKey | WAUJRPMLHIHAPT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 130.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|