C17H13N3O4S — CID 27285386
N-(4-nitrophenyl)-3-(1,3-thiazol-4-ylmethoxy)benzamide (PubChem CID 27285386) has the molecular formula C17H13N3O4S and a molecular weight of 355.38 g/mol. Its IUPAC name is N-(4-nitrophenyl)-3-(1,3-thiazol-4-ylmethoxy)benzamide.
| Compound Name | N-(4-nitrophenyl)-3-(1,3-thiazol-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 27285386 |
| Molecular Formula | C17H13N3O4S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | N-(4-nitrophenyl)-3-(1,3-thiazol-4-ylmethoxy)benzamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)c1cccc(OCc2cscn2)c1 |
| InChI | InChI=1S/C17H13N3O4S/c21-17(19-13-4-6-15(7-5-13)20(22)23)12-2-1-3-16(8-12)24-9-14-10-25-11-18-14/h1-8,10-11H,9H2,(H,19,21) |
| InChIKey | KBTWOYUZIURGAP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|