C18H13F3N2O3S — CID 27007482
3-(1,3-thiazol-4-ylmethoxy)-N-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 27007482) has the molecular formula C18H13F3N2O3S and a molecular weight of 394.37 g/mol. Its IUPAC name is 3-(1,3-thiazol-4-ylmethoxy)-N-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 3-(1,3-thiazol-4-ylmethoxy)-N-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 27007482 |
| Molecular Formula | C18H13F3N2O3S |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 3-(1,3-thiazol-4-ylmethoxy)-N-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)c1cccc(OCc2cscn2)c1 |
| InChI | InChI=1S/C18H13F3N2O3S/c19-18(20,21)26-15-6-4-13(5-7-15)23-17(24)12-2-1-3-16(8-12)25-9-14-10-27-11-22-14/h1-8,10-11H,9H2,(H,23,24) |
| InChIKey | JIWSGHBLESLATH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |