C22H16N2O4S2 — CID 34806518
[4-(thiophene-2-carbonylamino)phenyl] 3-(1,3-thiazol-4-ylmethoxy)benzoate (PubChem CID 34806518) has the molecular formula C22H16N2O4S2 and a molecular weight of 436.51 g/mol. Its IUPAC name is [4-(thiophene-2-carbonylamino)phenyl] 3-(1,3-thiazol-4-ylmethoxy)benzoate.
| Compound Name | [4-(thiophene-2-carbonylamino)phenyl] 3-(1,3-thiazol-4-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 34806518 |
| Molecular Formula | C22H16N2O4S2 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | [4-(thiophene-2-carbonylamino)phenyl] 3-(1,3-thiazol-4-ylmethoxy)benzoate |
| SMILES | O=C(Oc1ccc(NC(=O)c2cccs2)cc1)c1cccc(OCc2cscn2)c1 |
| InChI | InChI=1S/C22H16N2O4S2/c25-21(20-5-2-10-30-20)24-16-6-8-18(9-7-16)28-22(26)15-3-1-4-19(11-15)27-12-17-13-29-14-23-17/h1-11,13-14H,12H2,(H,24,25) |
| InChIKey | UBLNTNKRXBMHFR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|