C22H18N2O2S2 — CID 24682427
N-[phenyl(thiophen-2-yl)methyl]-3-(1,3-thiazol-4-ylmethoxy)benzamide (PubChem CID 24682427) has the molecular formula C22H18N2O2S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[phenyl(thiophen-2-yl)methyl]-3-(1,3-thiazol-4-ylmethoxy)benzamide.
| Compound Name | N-[phenyl(thiophen-2-yl)methyl]-3-(1,3-thiazol-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 24682427 |
| Molecular Formula | C22H18N2O2S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | N-[phenyl(thiophen-2-yl)methyl]-3-(1,3-thiazol-4-ylmethoxy)benzamide |
| SMILES | O=C(NC(c1ccccc1)c1cccs1)c1cccc(OCc2cscn2)c1 |
| InChI | InChI=1S/C22H18N2O2S2/c25-22(17-8-4-9-19(12-17)26-13-18-14-27-15-23-18)24-21(20-10-5-11-28-20)16-6-2-1-3-7-16/h1-12,14-15,21H,13H2,(H,24,25) |
| InChIKey | AYAHLXJBTVUBJZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |