C19H15N3OS — CID 27885939
N-[(S)-phenyl(thiophen-2-yl)methyl]-3H-benzimidazole-5-carboxamide (PubChem CID 27885939) has the molecular formula C19H15N3OS and a molecular weight of 333.42 g/mol. Its IUPAC name is N-[(S)-phenyl(thiophen-2-yl)methyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(S)-phenyl(thiophen-2-yl)methyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 27885939 |
| Molecular Formula | C19H15N3OS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-[(S)-phenyl(thiophen-2-yl)methyl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(N[C@@H](c1ccccc1)c1cccs1)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C19H15N3OS/c23-19(14-8-9-15-16(11-14)21-12-20-15)22-18(17-7-4-10-24-17)13-5-2-1-3-6-13/h1-12,18H,(H,20,21)(H,22,23)/t18-/m0/s1 |
| InChIKey | ADMQKHKTMSNJQW-SFHVURJKSA-N |
| XLogP | 4.14 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |