C19H14BrN3OS — CID 78886873
N-[3H-benzimidazol-5-yl(phenyl)methyl]-3-bromothiophene-2-carboxamide (PubChem CID 78886873) has the molecular formula C19H14BrN3OS and a molecular weight of 412.31 g/mol. Its IUPAC name is N-[3H-benzimidazol-5-yl(phenyl)methyl]-3-bromothiophene-2-carboxamide.
| Compound Name | N-[3H-benzimidazol-5-yl(phenyl)methyl]-3-bromothiophene-2-carboxamide |
|---|---|
| PubChem CID | 78886873 |
| Molecular Formula | C19H14BrN3OS |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | N-[3H-benzimidazol-5-yl(phenyl)methyl]-3-bromothiophene-2-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccc2nc[nH]c2c1)c1sccc1Br |
| InChI | InChI=1S/C19H14BrN3OS/c20-14-8-9-25-18(14)19(24)23-17(12-4-2-1-3-5-12)13-6-7-15-16(10-13)22-11-21-15/h1-11,17H,(H,21,22)(H,23,24) |
| InChIKey | ZGTOVNSSVBNBOJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |