C19H16BrNOS — CID 55757567
3-bromo-N-[(4-methylphenyl)-phenylmethyl]thiophene-2-carboxamide (PubChem CID 55757567) has the molecular formula C19H16BrNOS and a molecular weight of 386.31 g/mol. Its IUPAC name is 3-bromo-N-[(4-methylphenyl)-phenylmethyl]thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-[(4-methylphenyl)-phenylmethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55757567 |
| Molecular Formula | C19H16BrNOS |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 3-bromo-N-[(4-methylphenyl)-phenylmethyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C(NC(=O)c2sccc2Br)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16BrNOS/c1-13-7-9-15(10-8-13)17(14-5-3-2-4-6-14)21-19(22)18-16(20)11-12-23-18/h2-12,17H,1H3,(H,21,22) |
| InChIKey | XCSSQDBCJRNFBR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |