C23H19N3OS — CID 100749195
N-benzhydryl-4-(4-methylphenyl)thiadiazole-5-carboxamide (PubChem CID 100749195) has the molecular formula C23H19N3OS and a molecular weight of 385.49 g/mol. Its IUPAC name is N-benzhydryl-4-(4-methylphenyl)thiadiazole-5-carboxamide.
| Compound Name | N-benzhydryl-4-(4-methylphenyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 100749195 |
| Molecular Formula | C23H19N3OS |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-benzhydryl-4-(4-methylphenyl)thiadiazole-5-carboxamide |
| SMILES | Cc1ccc(-c2nnsc2C(=O)NC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19N3OS/c1-16-12-14-19(15-13-16)21-22(28-26-25-21)23(27)24-20(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15,20H,1H3,(H,24,27) |
| InChIKey | UIVAOWWCCWJRTP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |