C20H19N3O4S — CID 71844012
methyl (2R)-2-[[4-(4-methoxyphenyl)thiadiazole-5-carbonyl]amino]-3-phenylpropanoate (PubChem CID 71844012) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is methyl (2R)-2-[[4-(4-methoxyphenyl)thiadiazole-5-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-[[4-(4-methoxyphenyl)thiadiazole-5-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 71844012 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | methyl (2R)-2-[[4-(4-methoxyphenyl)thiadiazole-5-carbonyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)NC(=O)c1snnc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H19N3O4S/c1-26-15-10-8-14(9-11-15)17-18(28-23-22-17)19(24)21-16(20(25)27-2)12-13-6-4-3-5-7-13/h3-11,16H,12H2,1-2H3,(H,21,24)/t16-/m1/s1 |
| InChIKey | PIUJUNVLYQQMDL-MRXNPFEDSA-N |
| XLogP | 2.73 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |