C16H19N3O4S — CID 45495391
methyl (2S)-2-[[4-(4-methoxyphenyl)thiadiazole-5-carbonyl]amino]-3-methylbutanoate (PubChem CID 45495391) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is methyl (2S)-2-[[4-(4-methoxyphenyl)thiadiazole-5-carbonyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[4-(4-methoxyphenyl)thiadiazole-5-carbonyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 45495391 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | methyl (2S)-2-[[4-(4-methoxyphenyl)thiadiazole-5-carbonyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1snnc1-c1ccc(OC)cc1)C(C)C |
| InChI | InChI=1S/C16H19N3O4S/c1-9(2)12(16(21)23-4)17-15(20)14-13(18-19-24-14)10-5-7-11(22-3)8-6-10/h5-9,12H,1-4H3,(H,17,20)/t12-/m0/s1 |
| InChIKey | KXWRYCGHTBPKBX-LBPRGKRZSA-N |
| XLogP | 2.14 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |