C13H21N3O3S — CID 65210597
methyl 2-[(4-tert-butylthiadiazole-5-carbonyl)amino]-3-methylbutanoate (PubChem CID 65210597) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is methyl 2-[(4-tert-butylthiadiazole-5-carbonyl)amino]-3-methylbutanoate.
| Compound Name | methyl 2-[(4-tert-butylthiadiazole-5-carbonyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 65210597 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | methyl 2-[(4-tert-butylthiadiazole-5-carbonyl)amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)c1snnc1C(C)(C)C)C(C)C |
| InChI | InChI=1S/C13H21N3O3S/c1-7(2)8(12(18)19-6)14-11(17)9-10(13(3,4)5)15-16-20-9/h7-8H,1-6H3,(H,14,17) |
| InChIKey | GUTVDUPOPSPVMQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |