C14H23N3O3S — CID 81000063
tert-butyl (2R)-2-[(4-ethylthiadiazole-5-carbonyl)amino]-3-methylbutanoate (PubChem CID 81000063) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(4-ethylthiadiazole-5-carbonyl)amino]-3-methylbutanoate.
| Compound Name | tert-butyl (2R)-2-[(4-ethylthiadiazole-5-carbonyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 81000063 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | tert-butyl (2R)-2-[(4-ethylthiadiazole-5-carbonyl)amino]-3-methylbutanoate |
| SMILES | CCc1nnsc1C(=O)N[C@@H](C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C14H23N3O3S/c1-7-9-11(21-17-16-9)12(18)15-10(8(2)3)13(19)20-14(4,5)6/h8,10H,7H2,1-6H3,(H,15,18)/t10-/m1/s1 |
| InChIKey | TUIBJHIHHXRMGV-SNVBAGLBSA-N |
| XLogP | 2.20 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |