C16H25NO3S — CID 80701845
tert-butyl (2S)-2-[(3-ethylthiophene-2-carbonyl)amino]-3-methylbutanoate (PubChem CID 80701845) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3-ethylthiophene-2-carbonyl)amino]-3-methylbutanoate.
| Compound Name | tert-butyl (2S)-2-[(3-ethylthiophene-2-carbonyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 80701845 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | tert-butyl (2S)-2-[(3-ethylthiophene-2-carbonyl)amino]-3-methylbutanoate |
| SMILES | CCc1ccsc1C(=O)N[C@H](C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H25NO3S/c1-7-11-8-9-21-13(11)14(18)17-12(10(2)3)15(19)20-16(4,5)6/h8-10,12H,7H2,1-6H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | POYRTDITTGPEJN-LBPRGKRZSA-N |
| XLogP | 3.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |