C8H11NOS — CID 61341196
3-ethyl-N-methylthiophene-2-carboxamide (PubChem CID 61341196) has the molecular formula C8H11NOS and a molecular weight of 169.25 g/mol. Its IUPAC name is 3-ethyl-N-methylthiophene-2-carboxamide.
| Compound Name | 3-ethyl-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 61341196 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 3-ethyl-N-methylthiophene-2-carboxamide |
| SMILES | CCc1ccsc1C(=O)NC |
| InChI | InChI=1S/C8H11NOS/c1-3-6-4-5-11-7(6)8(10)9-2/h4-5H,3H2,1-2H3,(H,9,10) |
| InChIKey | NJVFLUPAUMMNHC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |