C10H12N2OS — CID 78989474
N-(1-cyanoethyl)-3-ethylthiophene-2-carboxamide (PubChem CID 78989474) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is N-(1-cyanoethyl)-3-ethylthiophene-2-carboxamide.
| Compound Name | N-(1-cyanoethyl)-3-ethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 78989474 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | N-(1-cyanoethyl)-3-ethylthiophene-2-carboxamide |
| SMILES | CCc1ccsc1C(=O)NC(C)C#N |
| InChI | InChI=1S/C10H12N2OS/c1-3-8-4-5-14-9(8)10(13)12-7(2)6-11/h4-5,7H,3H2,1-2H3,(H,12,13) |
| InChIKey | CEDZLUBSFHYKPN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |