About N-[(1S)-1-cyanoethyl]-1,3-thiazole-2-carboxamide
N-[(1S)-1-cyanoethyl]-1,3-thiazole-2-carboxamide (PubChem CID 130629014) has the molecular formula C7H7N3OS
and a molecular weight of 181.22 g/mol. Its IUPAC name is N-[(1S)-1-cyanoethyl]-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N-[(1S)-1-cyanoethyl]-1,3-thiazole-2-carboxamide |
| PubChem CID | 130629014 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | N-[(1S)-1-cyanoethyl]-1,3-thiazole-2-carboxamide |
| SMILES | C[C@@H](C#N)NC(=O)c1nccs1 |
| InChI | InChI=1S/C7H7N3OS/c1-5(4-8)10-6(11)7-9-2-3-12-7/h2-3,5H,1H3,(H,10,11)/t5-/m0/s1 |
| InChIKey | GKKJWZHQGLIWKN-YFKPBYRVSA-N |
| XLogP | 0.78 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1S)-1-cyanoethyl]-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-cyanoethyl]-1,3-thiazole-2-carboxamide?
The IUPAC name of N-[(1S)-1-cyanoethyl]-1,3-thiazole-2-carboxamide (CID 130629014) is N-[(1S)-1-cyanoethyl]-1,3-thiazole-2-carboxamide.
What is the SMILES notation for N-[(1S)-1-cyanoethyl]-1,3-thiazole-2-carboxamide?
The canonical SMILES for N-[(1S)-1-cyanoethyl]-1,3-thiazole-2-carboxamide is C[C@@H](C#N)NC(=O)c1nccs1.
What is the InChIKey of N-[(1S)-1-cyanoethyl]-1,3-thiazole-2-carboxamide?
The InChIKey is GKKJWZHQGLIWKN-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H7N3OS/c1-5(4-8)10-6(11)7-9-2-3-12-7/h2-3,5H,1H3,(H,10,11)/t5-/m0/s1.
What are the key properties of N-[(1S)-1-cyanoethyl]-1,3-thiazole-2-carboxamide?
N-[(1S)-1-cyanoethyl]-1,3-thiazole-2-carboxamide has a molecular weight of 181.22 g/mol, XLogP of 0.78, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-cyanoethyl]-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 130629014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).