C10H11N3O — CID 61121839
N-(1-cyanoethyl)-6-methylpyridine-3-carboxamide (PubChem CID 61121839) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is N-(1-cyanoethyl)-6-methylpyridine-3-carboxamide.
| Compound Name | N-(1-cyanoethyl)-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 61121839 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | N-(1-cyanoethyl)-6-methylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NC(C)C#N)cn1 |
| InChI | InChI=1S/C10H11N3O/c1-7-3-4-9(6-12-7)10(14)13-8(2)5-11/h3-4,6,8H,1-2H3,(H,13,14) |
| InChIKey | JQXKYAMNQZJOJT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |