About CID 69459233
CID 69459233 (PubChem CID 69459233) has the molecular formula C4H3LiNO2S
and a molecular weight of 136.08 g/mol.
Molecular Properties
| Compound Name | CID 69459233 |
| PubChem CID | 69459233 |
| Molecular Formula | C4H3LiNO2S |
| Molecular Weight | 136.08 g/mol |
| Exact Mass | 136.00 |
| IUPAC Name | — |
| SMILES | O=C(O)c1nccs1.[Li] |
| InChI | InChI=1S/C4H3NO2S.Li/c6-4(7)3-5-1-2-8-3;/h1-2H,(H,6,7); |
| InChIKey | WJUVQBYDRDZMQL-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.08 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 69459233 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69459233?
The IUPAC name of CID 69459233 (CID 69459233) is not available.
What is the SMILES notation for CID 69459233?
The canonical SMILES for CID 69459233 is O=C(O)c1nccs1.[Li].
What is the InChIKey of CID 69459233?
The InChIKey is WJUVQBYDRDZMQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2S.Li/c6-4(7)3-5-1-2-8-3;/h1-2H,(H,6,7);.
What are the key properties of CID 69459233?
CID 69459233 has a molecular weight of 136.08 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69459233 is sourced from PubChem (CID 69459233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).