C7H5F2NO2S — CID 64993249
4,4-difluoro-1-(1,3-thiazol-2-yl)butane-1,3-dione (PubChem CID 64993249) has the molecular formula C7H5F2NO2S and a molecular weight of 205.19 g/mol. Its IUPAC name is 4,4-difluoro-1-(1,3-thiazol-2-yl)butane-1,3-dione.
| Compound Name | 4,4-difluoro-1-(1,3-thiazol-2-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 64993249 |
| Molecular Formula | C7H5F2NO2S |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.00 |
| IUPAC Name | 4,4-difluoro-1-(1,3-thiazol-2-yl)butane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)F)c1nccs1 |
| InChI | InChI=1S/C7H5F2NO2S/c8-6(9)4(11)3-5(12)7-10-1-2-13-7/h1-2,6H,3H2 |
| InChIKey | KHTNXSQUZNNJFY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|