C5H6N2OSW — CID 178117150
carbanide;1,3-thiazole-2-carbonylazanide;tungsten(2+) (PubChem CID 178117150) has the molecular formula C5H6N2OSW and a molecular weight of 326.02 g/mol. Its IUPAC name is carbanide;1,3-thiazole-2-carbonylazanide;tungsten(2+).
| Compound Name | carbanide;1,3-thiazole-2-carbonylazanide;tungsten(2+) |
|---|---|
| PubChem CID | 178117150 |
| Molecular Formula | C5H6N2OSW |
| Molecular Weight | 326.02 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | carbanide;1,3-thiazole-2-carbonylazanide;tungsten(2+) |
| SMILES | [CH3-].[NH-]C(=O)c1nccs1.[W+2] |
| InChI | InChI=1S/C4H4N2OS.CH3.W/c5-3(7)4-6-1-2-8-4;;/h1-2H,(H2,5,7);1H3;/q;-1;+2/p-1 |
| InChIKey | CKNROYFBDWSXHA-UHFFFAOYSA-M |
| XLogP | 1.78 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.02 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|