C8H9NOS3 — CID 2740108
3,3-bis(methylsulfanyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-one (PubChem CID 2740108) has the molecular formula C8H9NOS3 and a molecular weight of 231.37 g/mol. Its IUPAC name is 3,3-bis(methylsulfanyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-one.
| Compound Name | 3,3-bis(methylsulfanyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 2740108 |
| Molecular Formula | C8H9NOS3 |
| Molecular Weight | 231.37 g/mol |
| Exact Mass | 230.98 |
| IUPAC Name | 3,3-bis(methylsulfanyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-one |
| SMILES | CSC(=CC(=O)c1nccs1)SC |
| InChI | InChI=1S/C8H9NOS3/c1-11-7(12-2)5-6(10)8-9-3-4-13-8/h3-5H,1-2H3 |
| InChIKey | QNEGVDRBKNQPKJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|