C17H21NO6S — CID 10451600
(Z)-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1-(1,3-thiazol-2-yl)prop-2-en-1-one (PubChem CID 10451600) has the molecular formula C17H21NO6S and a molecular weight of 367.42 g/mol. Its IUPAC name is (Z)-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1-(1,3-thiazol-2-yl)prop-2-en-1-one.
| Compound Name | (Z)-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1-(1,3-thiazol-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 10451600 |
| Molecular Formula | C17H21NO6S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | (Z)-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1-(1,3-thiazol-2-yl)prop-2-en-1-one |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](/C=C\C(=O)c1nccs1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C17H21NO6S/c1-16(2)21-11-10(6-5-9(19)14-18-7-8-25-14)20-15-13(12(11)22-16)23-17(3,4)24-15/h5-8,10-13,15H,1-4H3/b6-5-/t10-,11+,12+,13-,15-/m1/s1 |
| InChIKey | VFWMPNQWXYKJBQ-HYYSRIDTSA-N |
| XLogP | 2.28 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|