C10H9N3OS — CID 122635097
(E)-3-(2-methylpyrazol-3-yl)-1-(1,3-thiazol-2-yl)prop-2-en-1-one (PubChem CID 122635097) has the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. Its IUPAC name is (E)-3-(2-methylpyrazol-3-yl)-1-(1,3-thiazol-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-methylpyrazol-3-yl)-1-(1,3-thiazol-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 122635097 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | (E)-3-(2-methylpyrazol-3-yl)-1-(1,3-thiazol-2-yl)prop-2-en-1-one |
| SMILES | Cn1nccc1/C=C/C(=O)c1nccs1 |
| InChI | InChI=1S/C10H9N3OS/c1-13-8(4-5-12-13)2-3-9(14)10-11-6-7-15-10/h2-7H,1H3/b3-2+ |
| InChIKey | CBIWWMISDDOZRR-NSCUHMNNSA-N |
| XLogP | 1.77 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|