About 1-[2-(1-methylpyrazol-3-yl)-1,3-thiazol-4-yl]ethanone
1-[2-(1-methylpyrazol-3-yl)-1,3-thiazol-4-yl]ethanone (PubChem CID 65198190) has the molecular formula C9H9N3OS
and a molecular weight of 207.26 g/mol. Its IUPAC name is 1-[2-(1-methylpyrazol-3-yl)-1,3-thiazol-4-yl]ethanone.
Analyze 1-[2-(1-methylpyrazol-3-yl)-1,3-thiazol-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1-methylpyrazol-3-yl)-1,3-thiazol-4-yl]ethanone?
The IUPAC name of 1-[2-(1-methylpyrazol-3-yl)-1,3-thiazol-4-yl]ethanone (CID 65198190) is 1-[2-(1-methylpyrazol-3-yl)-1,3-thiazol-4-yl]ethanone.
What is the SMILES notation for 1-[2-(1-methylpyrazol-3-yl)-1,3-thiazol-4-yl]ethanone?
The canonical SMILES for 1-[2-(1-methylpyrazol-3-yl)-1,3-thiazol-4-yl]ethanone is CC(=O)c1csc(-c2ccn(C)n2)n1.
What is the InChIKey of 1-[2-(1-methylpyrazol-3-yl)-1,3-thiazol-4-yl]ethanone?
The InChIKey is GLQZGOHDTJSQJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3OS/c1-6(13)8-5-14-9(10-8)7-3-4-12(2)11-7/h3-5H,1-2H3.
What are the key properties of 1-[2-(1-methylpyrazol-3-yl)-1,3-thiazol-4-yl]ethanone?
1-[2-(1-methylpyrazol-3-yl)-1,3-thiazol-4-yl]ethanone has a molecular weight of 207.26 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1-methylpyrazol-3-yl)-1,3-thiazol-4-yl]ethanone is sourced from PubChem (CID 65198190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).