C12H12N4OS — CID 146104676
N-[[2-(1-methylpyrazol-3-yl)-1,3-thiazol-4-yl]methyl]but-2-ynamide (PubChem CID 146104676) has the molecular formula C12H12N4OS and a molecular weight of 260.32 g/mol. Its IUPAC name is N-[[2-(1-methylpyrazol-3-yl)-1,3-thiazol-4-yl]methyl]but-2-ynamide.
| Compound Name | N-[[2-(1-methylpyrazol-3-yl)-1,3-thiazol-4-yl]methyl]but-2-ynamide |
|---|---|
| PubChem CID | 146104676 |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | N-[[2-(1-methylpyrazol-3-yl)-1,3-thiazol-4-yl]methyl]but-2-ynamide |
| SMILES | CC#CC(=O)NCc1csc(-c2ccn(C)n2)n1 |
| InChI | InChI=1S/C12H12N4OS/c1-3-4-11(17)13-7-9-8-18-12(14-9)10-5-6-16(2)15-10/h5-6,8H,7H2,1-2H3,(H,13,17) |
| InChIKey | KBQQQUOIOKHSPR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|